
Материал из Википедии — свободной энциклопедии
Перейти к: навигация, поиск

{{Drugbox | Verifiedfields = changed | UNII_Ref =  ✔ | UNII = 5970HH9923 | verifiedrevid = 477499263 | ImageFile = Mafosfamide.svg | ImageSize = 200 | ImageAlt = Skeletal formula | ImageFile1 = Mafosfamide-3D-balls.png | ImageSize1 = 240 | ImageAlt1 = Ball-and-stick model |IUPACName=2-{(2-[bis(2-chloroethyl)amino]-2-oxido-1,3,2-oxazaphosphinan-4-yl}thio)ethanesulfonic acid |OtherNames=2-{[2-[bis(2-chloroethyl)amino]-2-oxo-1-oxa-3-aza-2λ5-phosphacyclohex-4-yl}sulfanyl]ethanesulfonic acid | InChI = 1/C9H19Cl2N2O5PS2/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17/h9H,1-8H2,(H,12,14)(H,15,16,17)/t9-,19-/m1/s1 | InChIKey = PBUUPFTVAPUWDE-AYLIAGHABO | StdInChI_Ref =  ✔ | StdInChI = 1S/C9H19Cl2N2O5PS2/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17/h9H,1-8H2,(H,12,14)(H,15,16,17)/t9-,19-/m1/s1 | StdInChIKey_Ref =  ✔ | StdInChIKey = PBUUPFTVAPUWDE-AYLIAGHASA-N | CASNo_Ref =  N | CASNo=88859-04-5 | PubChem=104746 | ChemSpiderID_Ref =  ✔ | ChemSpiderID=16736958 | SMILES = O=P1(N[C@@H](CCO1)SCCS(O)(=O)=O)N(CCCl)CCCl | MeSHName=Mafosfamide | Formula=C9H19Cl2N2O5PS2 | MolarMass=401.269 g/mol }} Мафосфамид — это новый, экспериментальный цитостатический противоопухолевый химиотерапевтический лекарственный препарат алкилирующего типа действия. Относится к группе производных оксазафосфорина, диамидофосфатам и одновременно к группе производных бис-β-хлорэтиламина. Является химически стабильным (в отличие от самого 4-гидроксициклофосфамида) 4-тиоэтансульфоновым эфиром 4-гидроксициклофосфамида, основного активного печёночного метаболита циклофосфамида и внутриклеточного активного метаболита перфосфамида. На данный момент мафосфамид прошёл несколько клинических испытаний I фазы.[1][2]

Ссылки[править | править вики-текст]

  1. Intrathecal Mafosfamide. ClinicalTrials.gov. U.S. NIH (August 21, 2006). Проверено 13 июля 2007. ClinicalTrials.gov Identifier NCT00062881.
  2. Mafosfamide in Treating Patients With Progressive or Refractory Meningeal Tumors. ClinicalTrials.gov. U.S. NIH (February 20, 2007). Проверено 13 июля 2007. ClinicalTrials.gov Identifier NCT00031928.