Лотавстралин

Материал из Википедии — свободной энциклопедии
Перейти к: навигация, поиск

{{Вещество

| заголовок                 = 
| картинка                  = Lotaustralin Structural Formulae V.1.svg
| картинка3D                = 
| картинка малая            = 
| наименование              = (2R)-2-метил-2-{[(2S,3R,4S,5S,6R)-3,4,5-тригидрокси-6-(гидроксиметил)тетрагидро-2H-пиран-2-ил]окси}бутаннитрил
| традиционные названия     = 
| сокращения                = 
| хим. формула              =  C11H19NO6
| рац. формула              = 
| состояние                 = 
| примеси                   = 
| молярная концентрация     = 
| молярная масса            = 261.27
| плотность                 = 
| предел прочности          = 
| твёрдость                 = 
| поверхностное натяжение   = 
| динамическая вязкость     = 
| кинематическая вязкость   = 
| скорость звука            = 
| энергия ионизации         = 
| проводимость              = 
| уд. электр. сопротивление = 
| коэфф. электр. сопротив.  = 
| темп. плавления           = 139
| температура размягчения   = 
| темп. кипения             = 
| темп. кипения пр.         = 
| темп. сублимации          = 
| темп. разложения          = 
| темп. вспышки             = 
| фазовые переходы          = 
| темп. стеклования         = 
| темп. воспламенения       = 
| темп. самовоспламенения   = 
| пределы взрываемости      = 
| тройная точка             = 
| критическая точка         = 
| критическая темп.         = 
| критическое давление      = 
| критическая плотность     = 
| теплоёмкость              = 
| теплоёмкость2             = 
| теплопроводность          = 
| энтальпия образования     = 
| энтальпия плавления       = 
| энтальпия кипения         = 
| энтальпия растворения     = 
| энтальпия сублимации      = 
| удельная теплота парообразования = 
| удельная теплота плавления       = 
| тепловое расширение       = 
| интервал трансформации    = 
| давление пара             = 
| константа В. дер В.       = 
| конст. диссоц. кислоты    = 
| растворимость             = 
| растворимость1            = 
|   вещество1               = 
| растворимость2            = 
|   вещество2               = 
| растворимость3            = 
|   вещество3               = 
| растворимость4            = 
|   вещество4               = 
| вращение                  = 
| изоэлектрическая точка    = 
| от. диэлектр. прониц.     = 
| диапазон прозрачности     = 
| показатель преломления    = 
| угол Брюстера             = 
| гибридизация              = 
| координационная геометрия = 
| кристаллическая структура = 
| дипольный момент          = 
| CAS                       = 534-67-8
| PubChem                   =  441467
| EINECS                    = 
| SMILES                    = CC[C@](C)(C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O
| ЕС                        = 
| RTECS                     = 
| ChEBI                     = 
| ООН                       = 
| ПДК                       = 
| ЛД50                      = мыши, орально - 300 мг/кг; крысы, орально - 980 мг/кг; кролики, орально - 3200 мг/кг[1]
| токсичность               = 
| R-фразы                   = 
| S-фразы                   = 
| H-фразы                   = 
| P-фразы                   = 
| сигнальное слово          = 
| СГС                       = 

| NFPA 704 =

NFPA 704.svg

}} Лотавстралин — глюкозид циангидрина метилэтилкетона, цианогенный гликозид, содержащийся в некоторых бобовых растениях (клевер ползучий, Lotus australis, Phaseolus lunatus), растениях родов родиола (родиола розовая и родиола кириллова) и маниок, а также ряде других растений.

Лотавстралин структурно близок линамарину — глюкозиду ацетонциангидрина, оба гликозида гидролизуются под действием β-гликозидазы линамаразы[2] с образованием глюкозы и циангидрина кетона, который затем самопроизвольно гидролизуется с образованием кетона и синильной кислоты.

См. также[править | править вики-текст]

Примечания[править | править вики-текст]